C23H36O6 — CID 11711234
[(2S)-2-[(1E,3R,4S,8R,9R,10R,11S,14S)-4,8,9-trihydroxy-14-(methoxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl]propyl] acetate (PubChem CID 11711234) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is [(2S)-2-[(1E,3R,4S,8R,9R,10R,11S,14S)-4,8,9-trihydroxy-14-(methoxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl]propyl] acetate.
| Compound Name | [(2S)-2-[(1E,3R,4S,8R,9R,10R,11S,14S)-4,8,9-trihydroxy-14-(methoxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl]propyl] acetate |
|---|---|
| PubChem CID | 11711234 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [(2S)-2-[(1E,3R,4S,8R,9R,10R,11S,14S)-4,8,9-trihydroxy-14-(methoxymethyl)-3,10-dimethyl-6-tricyclo[9.3.0.03,7]tetradeca-1,6-dienyl]propyl] acetate |
| SMILES | COC[C@H]1CC[C@@H]2/C1=C\[C@]1(C)C(=C([C@H](C)COC(C)=O)C[C@@H]1O)[C@@H](O)[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C23H36O6/c1-12(10-29-14(3)24)17-8-19(25)23(4)9-18-15(11-28-5)6-7-16(18)13(2)21(26)22(27)20(17)23/h9,12-13,15-16,19,21-22,25-27H,6-8,10-11H2,1-5H3/b18-9-/t12-,13-,15-,16+,19+,21-,22-,23+/m1/s1 |
| InChIKey | JWXDGEQLSBXQMO-FXMNBVRKSA-N |
| XLogP | 2.22 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|