C18H20F6N2O2 — CID 11711262
N-(4-cyanobutyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methylpropanamide (PubChem CID 11711262) has the molecular formula C18H20F6N2O2 and a molecular weight of 410.36 g/mol. Its IUPAC name is N-(4-cyanobutyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methylpropanamide.
| Compound Name | N-(4-cyanobutyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 11711262 |
| Molecular Formula | C18H20F6N2O2 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-(4-cyanobutyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N(CCCCC#N)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F6N2O2/c1-12(2)15(27)26(11-5-3-4-10-25)14-8-6-13(7-9-14)16(28,17(19,20)21)18(22,23)24/h6-9,12,28H,3-5,11H2,1-2H3 |
| InChIKey | OREZBGBKIZUJOU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|