C15H22BrNO — CID 117114628
2-(1-aminocyclohexyl)-4-bromo-3,5,6-trimethylphenol (PubChem CID 117114628) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is 2-(1-aminocyclohexyl)-4-bromo-3,5,6-trimethylphenol.
| Compound Name | 2-(1-aminocyclohexyl)-4-bromo-3,5,6-trimethylphenol |
|---|---|
| PubChem CID | 117114628 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-(1-aminocyclohexyl)-4-bromo-3,5,6-trimethylphenol |
| SMILES | Cc1c(C)c(Br)c(C)c(C2(N)CCCCC2)c1O |
| InChI | InChI=1S/C15H22BrNO/c1-9-10(2)14(18)12(11(3)13(9)16)15(17)7-5-4-6-8-15/h18H,4-8,17H2,1-3H3 |
| InChIKey | ZWCBROXWCHHBDB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|