About 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol
4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol (PubChem CID 11711527) has the molecular formula C19H19F6NOS
and a molecular weight of 423.42 g/mol. Its IUPAC name is 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol.
Molecular Properties
| Compound Name | 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol |
| PubChem CID | 11711527 |
| Molecular Formula | C19H19F6NOS |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol |
| SMILES | NCCC(O)(CSCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H19F6NOS/c20-18(21,22)15-8-13(9-16(10-15)19(23,24)25)11-28-12-17(27,6-7-26)14-4-2-1-3-5-14/h1-5,8-10,27H,6-7,11-12,26H2 |
| InChIKey | VAMGZGKHPJATGW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol?
The IUPAC name of 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol (CID 11711527) is 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol.
What is the SMILES notation for 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol?
The canonical SMILES for 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol is NCCC(O)(CSCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1.
What is the InChIKey of 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol?
The InChIKey is VAMGZGKHPJATGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F6NOS/c20-18(21,22)15-8-13(9-16(10-15)19(23,24)25)11-28-12-17(27,6-7-26)14-4-2-1-3-5-14/h1-5,8-10,27H,6-7,11-12,26H2.
What are the key properties of 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol?
4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol has a molecular weight of 423.42 g/mol, XLogP of 5.19, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[[3,5-bis(trifluoromethyl)phenyl]methylsulfanyl]-2-phenylbutan-2-ol is sourced from PubChem (CID 11711527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).