C15H23NO — CID 117115655
4-[2-[1-(methoxymethyl)cyclopropyl]phenyl]butan-1-amine (PubChem CID 117115655) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-[2-[1-(methoxymethyl)cyclopropyl]phenyl]butan-1-amine.
| Compound Name | 4-[2-[1-(methoxymethyl)cyclopropyl]phenyl]butan-1-amine |
|---|---|
| PubChem CID | 117115655 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 4-[2-[1-(methoxymethyl)cyclopropyl]phenyl]butan-1-amine |
| SMILES | COCC1(c2ccccc2CCCCN)CC1 |
| InChI | InChI=1S/C15H23NO/c1-17-12-15(9-10-15)14-8-3-2-6-13(14)7-4-5-11-16/h2-3,6,8H,4-5,7,9-12,16H2,1H3 |
| InChIKey | VNLOCVGNMDQRAF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|