C12H19BrN2 — CID 117115684
5-(4-aminobutyl)-2-bromo-N,N-dimethylaniline (PubChem CID 117115684) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 5-(4-aminobutyl)-2-bromo-N,N-dimethylaniline.
| Compound Name | 5-(4-aminobutyl)-2-bromo-N,N-dimethylaniline |
|---|---|
| PubChem CID | 117115684 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-(4-aminobutyl)-2-bromo-N,N-dimethylaniline |
| SMILES | CN(C)c1cc(CCCCN)ccc1Br |
| InChI | InChI=1S/C12H19BrN2/c1-15(2)12-9-10(5-3-4-8-14)6-7-11(12)13/h6-7,9H,3-5,8,14H2,1-2H3 |
| InChIKey | CHSOYVZCAATBAM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|