About 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine
1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine (PubChem CID 117116150) has the molecular formula C10H9ClF3N
and a molecular weight of 235.64 g/mol. Its IUPAC name is 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine |
| PubChem CID | 117116150 |
| Molecular Formula | C10H9ClF3N |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine |
| SMILES | NC1(Cc2cc(F)c(F)c(Cl)c2F)CC1 |
| InChI | InChI=1S/C10H9ClF3N/c11-7-8(13)5(3-6(12)9(7)14)4-10(15)1-2-10/h3H,1-2,4,15H2 |
| InChIKey | QSBTWCQSLPXIBC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine?
The IUPAC name of 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine (CID 117116150) is 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine?
The canonical SMILES for 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine is NC1(Cc2cc(F)c(F)c(Cl)c2F)CC1.
What is the InChIKey of 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine?
The InChIKey is QSBTWCQSLPXIBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF3N/c11-7-8(13)5(3-6(12)9(7)14)4-10(15)1-2-10/h3H,1-2,4,15H2.
What are the key properties of 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine?
1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine has a molecular weight of 235.64 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-chloro-2,4,5-trifluorophenyl)methyl]cyclopropan-1-amine is sourced from PubChem (CID 117116150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).