C11H11F4N — CID 117116945
2-methyl-2-(2,3,4,5-tetrafluorophenyl)pyrrolidine (PubChem CID 117116945) has the molecular formula C11H11F4N and a molecular weight of 233.21 g/mol. Its IUPAC name is 2-methyl-2-(2,3,4,5-tetrafluorophenyl)pyrrolidine.
| Compound Name | 2-methyl-2-(2,3,4,5-tetrafluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 117116945 |
| Molecular Formula | C11H11F4N |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-methyl-2-(2,3,4,5-tetrafluorophenyl)pyrrolidine |
| SMILES | CC1(c2cc(F)c(F)c(F)c2F)CCCN1 |
| InChI | InChI=1S/C11H11F4N/c1-11(3-2-4-16-11)6-5-7(12)9(14)10(15)8(6)13/h5,16H,2-4H2,1H3 |
| InChIKey | BWPXLEBWVYVLDG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|