C11H8BrF4NO2 — CID 117117085
5-(4-bromo-2,3,5,6-tetrafluorophenyl)pyrrolidine-3-carboxylic acid (PubChem CID 117117085) has the molecular formula C11H8BrF4NO2 and a molecular weight of 342.09 g/mol. Its IUPAC name is 5-(4-bromo-2,3,5,6-tetrafluorophenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(4-bromo-2,3,5,6-tetrafluorophenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117117085 |
| Molecular Formula | C11H8BrF4NO2 |
| Molecular Weight | 342.09 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 5-(4-bromo-2,3,5,6-tetrafluorophenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNC(c2c(F)c(F)c(Br)c(F)c2F)C1 |
| InChI | InChI=1S/C11H8BrF4NO2/c12-6-9(15)7(13)5(8(14)10(6)16)4-1-3(2-17-4)11(18)19/h3-4,17H,1-2H2,(H,18,19) |
| InChIKey | UKBWDAZATWSKNE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.09 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|