About 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal
3-(4-hydroxy-2,3,6-trimethylphenyl)propanal (PubChem CID 117117751) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal.
Molecular Properties
| Compound Name | 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal |
| PubChem CID | 117117751 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal |
| SMILES | Cc1cc(O)c(C)c(C)c1CCC=O |
| InChI | InChI=1S/C12H16O2/c1-8-7-12(14)10(3)9(2)11(8)5-4-6-13/h6-7,14H,4-5H2,1-3H3 |
| InChIKey | PDECVBVOQDWJDP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal?
The IUPAC name of 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal (CID 117117751) is 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal.
What is the SMILES notation for 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal?
The canonical SMILES for 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal is Cc1cc(O)c(C)c(C)c1CCC=O.
What is the InChIKey of 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal?
The InChIKey is PDECVBVOQDWJDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-8-7-12(14)10(3)9(2)11(8)5-4-6-13/h6-7,14H,4-5H2,1-3H3.
What are the key properties of 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal?
3-(4-hydroxy-2,3,6-trimethylphenyl)propanal has a molecular weight of 192.26 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-2,3,6-trimethylphenyl)propanal is sourced from PubChem (CID 117117751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).