About 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal
3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal (PubChem CID 117117807) has the molecular formula C9H5BrF4O
and a molecular weight of 285.03 g/mol. Its IUPAC name is 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal.
Molecular Properties
| Compound Name | 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal |
| PubChem CID | 117117807 |
| Molecular Formula | C9H5BrF4O |
| Molecular Weight | 285.03 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal |
| SMILES | O=CCCc1c(F)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C9H5BrF4O/c10-5-8(13)6(11)4(2-1-3-15)7(12)9(5)14/h3H,1-2H2 |
| InChIKey | VHLMMJXKJSZUGY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.03 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal?
The IUPAC name of 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal (CID 117117807) is 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal.
What is the SMILES notation for 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal?
The canonical SMILES for 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal is O=CCCc1c(F)c(F)c(Br)c(F)c1F.
What is the InChIKey of 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal?
The InChIKey is VHLMMJXKJSZUGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrF4O/c10-5-8(13)6(11)4(2-1-3-15)7(12)9(5)14/h3H,1-2H2.
What are the key properties of 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal?
3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal has a molecular weight of 285.03 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanal is sourced from PubChem (CID 117117807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).