C12H14F3N — CID 117118174
2-[(2,3,5-trifluorophenyl)methyl]piperidine (PubChem CID 117118174) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-[(2,3,5-trifluorophenyl)methyl]piperidine.
| Compound Name | 2-[(2,3,5-trifluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 117118174 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-[(2,3,5-trifluorophenyl)methyl]piperidine |
| SMILES | Fc1cc(F)c(F)c(CC2CCCCN2)c1 |
| InChI | InChI=1S/C12H14F3N/c13-9-5-8(12(15)11(14)7-9)6-10-3-1-2-4-16-10/h5,7,10,16H,1-4,6H2 |
| InChIKey | FWEZCGPRGQPBIN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|