C15H20F2N2O — CID 117118279
4-[4,5-difluoro-2-(pyrrolidin-2-ylmethyl)phenyl]morpholine (PubChem CID 117118279) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 4-[4,5-difluoro-2-(pyrrolidin-2-ylmethyl)phenyl]morpholine.
| Compound Name | 4-[4,5-difluoro-2-(pyrrolidin-2-ylmethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 117118279 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[4,5-difluoro-2-(pyrrolidin-2-ylmethyl)phenyl]morpholine |
| SMILES | Fc1cc(CC2CCCN2)c(N2CCOCC2)cc1F |
| InChI | InChI=1S/C15H20F2N2O/c16-13-9-11(8-12-2-1-3-18-12)15(10-14(13)17)19-4-6-20-7-5-19/h9-10,12,18H,1-8H2 |
| InChIKey | QJBOPLYYMWADBC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |