C17H21NO2 — CID 117118656
2-(1-cyclohexylindol-7-yl)propanoic acid (PubChem CID 117118656) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(1-cyclohexylindol-7-yl)propanoic acid.
| Compound Name | 2-(1-cyclohexylindol-7-yl)propanoic acid |
|---|---|
| PubChem CID | 117118656 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-(1-cyclohexylindol-7-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1cccc2ccn(C3CCCCC3)c12 |
| InChI | InChI=1S/C17H21NO2/c1-12(17(19)20)15-9-5-6-13-10-11-18(16(13)15)14-7-3-2-4-8-14/h5-6,9-12,14H,2-4,7-8H2,1H3,(H,19,20) |
| InChIKey | OABJZDVWXDGFOI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |