C25H35NO4Si — CID 11711892
10-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-7-methoxy-3a,3b,4,5,11,11a-hexahydronaphtho[2,1-e]isoindole-1,3-dione (PubChem CID 11711892) has the molecular formula C25H35NO4Si and a molecular weight of 441.64 g/mol. Its IUPAC name is 10-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-7-methoxy-3a,3b,4,5,11,11a-hexahydronaphtho[2,1-e]isoindole-1,3-dione.
| Compound Name | 10-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-7-methoxy-3a,3b,4,5,11,11a-hexahydronaphtho[2,1-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11711892 |
| Molecular Formula | C25H35NO4Si |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 10-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-7-methoxy-3a,3b,4,5,11,11a-hexahydronaphtho[2,1-e]isoindole-1,3-dione |
| SMILES | CCN1C(=O)C2CC(O[Si](C)(C)C(C)(C)C)=C3c4ccc(OC)cc4CCC3C2C1=O |
| InChI | InChI=1S/C25H35NO4Si/c1-8-26-23(27)19-14-20(30-31(6,7)25(2,3)4)21-17-12-10-16(29-5)13-15(17)9-11-18(21)22(19)24(26)28/h10,12-13,18-19,22H,8-9,11,14H2,1-7H3 |
| InChIKey | QXUHUBSOGKDCSW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|