3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid

C11H9BrO4S — CID 117120218

IUPAC3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid
SMILESO=C(O)CCC1=Cc2c(Br)cccc2S1(=O)=O
InChIInChI=1S/C11H9BrO4S/c12-9-2-1-3-10-8(9)6-7(17(10,15)16)4-5-11(13)14/h1-3,6H,4-5H2,(H,13,14)
InChIKeyDYWXIPNOVJZMJJ-UHFFFAOYSA-N
MW317.16 g/mol
LogP2.44
Rot. Bonds3

About 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid

3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid (PubChem CID 117120218) has the molecular formula C11H9BrO4S and a molecular weight of 317.16 g/mol. Its IUPAC name is 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid
PubChem CID117120218
Molecular FormulaC11H9BrO4S
Molecular Weight317.16 g/mol
Exact Mass315.94
IUPAC Name3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid
SMILESO=C(O)CCC1=Cc2c(Br)cccc2S1(=O)=O
InChIInChI=1S/C11H9BrO4S/c12-9-2-1-3-10-8(9)6-7(17(10,15)16)4-5-11(13)14/h1-3,6H,4-5H2,(H,13,14)
InChIKeyDYWXIPNOVJZMJJ-UHFFFAOYSA-N
XLogP2.44
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.16
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid?
The IUPAC name of 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid (CID 117120218) is 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid.
What is the SMILES notation for 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid?
The canonical SMILES for 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid is O=C(O)CCC1=Cc2c(Br)cccc2S1(=O)=O.
What is the InChIKey of 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid?
The InChIKey is DYWXIPNOVJZMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrO4S/c12-9-2-1-3-10-8(9)6-7(17(10,15)16)4-5-11(13)14/h1-3,6H,4-5H2,(H,13,14).
What are the key properties of 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid?
3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid has a molecular weight of 317.16 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid is sourced from PubChem (CID 117120218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).