C11H9BrO4S — CID 117120218
3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid (PubChem CID 117120218) has the molecular formula C11H9BrO4S and a molecular weight of 317.16 g/mol. Its IUPAC name is 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid.
| Compound Name | 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 117120218 |
| Molecular Formula | C11H9BrO4S |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 3-(4-bromo-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid |
| SMILES | O=C(O)CCC1=Cc2c(Br)cccc2S1(=O)=O |
| InChI | InChI=1S/C11H9BrO4S/c12-9-2-1-3-10-8(9)6-7(17(10,15)16)4-5-11(13)14/h1-3,6H,4-5H2,(H,13,14) |
| InChIKey | DYWXIPNOVJZMJJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |