C14H19ClN2 — CID 117120480
3-(4-chloro-1-propan-2-ylindol-2-yl)propan-1-amine (PubChem CID 117120480) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 3-(4-chloro-1-propan-2-ylindol-2-yl)propan-1-amine.
| Compound Name | 3-(4-chloro-1-propan-2-ylindol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 117120480 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-(4-chloro-1-propan-2-ylindol-2-yl)propan-1-amine |
| SMILES | CC(C)n1c(CCCN)cc2c(Cl)cccc21 |
| InChI | InChI=1S/C14H19ClN2/c1-10(2)17-11(5-4-8-16)9-12-13(15)6-3-7-14(12)17/h3,6-7,9-10H,4-5,8,16H2,1-2H3 |
| InChIKey | LWBAZRSWXZWNBG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |