C24H26F3NO4 — CID 11712055
3-[1-(4-methoxyphenyl)ethenyl]-N-[3-(trifluoromethyl)phenyl]-1,2,5-trioxaspiro[5.5]undecan-9-amine (PubChem CID 11712055) has the molecular formula C24H26F3NO4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenyl)ethenyl]-N-[3-(trifluoromethyl)phenyl]-1,2,5-trioxaspiro[5.5]undecan-9-amine.
| Compound Name | 3-[1-(4-methoxyphenyl)ethenyl]-N-[3-(trifluoromethyl)phenyl]-1,2,5-trioxaspiro[5.5]undecan-9-amine |
|---|---|
| PubChem CID | 11712055 |
| Molecular Formula | C24H26F3NO4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 3-[1-(4-methoxyphenyl)ethenyl]-N-[3-(trifluoromethyl)phenyl]-1,2,5-trioxaspiro[5.5]undecan-9-amine |
| SMILES | C=C(c1ccc(OC)cc1)C1COC2(CCC(Nc3cccc(C(F)(F)F)c3)CC2)OO1 |
| InChI | InChI=1S/C24H26F3NO4/c1-16(17-6-8-21(29-2)9-7-17)22-15-30-23(32-31-22)12-10-19(11-13-23)28-20-5-3-4-18(14-20)24(25,26)27/h3-9,14,19,22,28H,1,10-13,15H2,2H3 |
| InChIKey | ULPSIRIYEGTGEV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|