About 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine
3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine (PubChem CID 117120778) has the molecular formula C12H12F3NO2S
and a molecular weight of 291.29 g/mol. Its IUPAC name is 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine |
| PubChem CID | 117120778 |
| Molecular Formula | C12H12F3NO2S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine |
| SMILES | NCCCC1=CS(=O)(=O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C12H12F3NO2S/c13-12(14,15)9-3-4-11-10(6-9)8(2-1-5-16)7-19(11,17)18/h3-4,6-7H,1-2,5,16H2 |
| InChIKey | UJPBMBFAOCRVIE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine?
The IUPAC name of 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine (CID 117120778) is 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine.
What is the SMILES notation for 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine?
The canonical SMILES for 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine is NCCCC1=CS(=O)(=O)c2ccc(C(F)(F)F)cc21.
What is the InChIKey of 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine?
The InChIKey is UJPBMBFAOCRVIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO2S/c13-12(14,15)9-3-4-11-10(6-9)8(2-1-5-16)7-19(11,17)18/h3-4,6-7H,1-2,5,16H2.
What are the key properties of 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine?
3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine has a molecular weight of 291.29 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,1-dioxo-5-(trifluoromethyl)-1-benzothiophen-3-yl]propan-1-amine is sourced from PubChem (CID 117120778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).