C12H12O5S — CID 117120915
3-(5-methoxy-1,1-dioxo-1-benzothiophen-3-yl)propanoic acid (PubChem CID 117120915) has the molecular formula C12H12O5S and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-(5-methoxy-1,1-dioxo-1-benzothiophen-3-yl)propanoic acid.
| Compound Name | 3-(5-methoxy-1,1-dioxo-1-benzothiophen-3-yl)propanoic acid |
|---|---|
| PubChem CID | 117120915 |
| Molecular Formula | C12H12O5S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 3-(5-methoxy-1,1-dioxo-1-benzothiophen-3-yl)propanoic acid |
| SMILES | COc1ccc2c(c1)C(CCC(=O)O)=CS2(=O)=O |
| InChI | InChI=1S/C12H12O5S/c1-17-9-3-4-11-10(6-9)8(2-5-12(13)14)7-18(11,15)16/h3-4,6-7H,2,5H2,1H3,(H,13,14) |
| InChIKey | WFWGEGWNEOSTRI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |