C20H22F6N2O3 — CID 11712118
N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]pentanamide (PubChem CID 11712118) has the molecular formula C20H22F6N2O3 and a molecular weight of 452.40 g/mol. Its IUPAC name is N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]pentanamide.
| Compound Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 11712118 |
| Molecular Formula | C20H22F6N2O3 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1onc(C(C)C)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F6N2O3/c1-4-5-6-14(29)27-17-15(16(11(2)3)28-31-17)12-7-9-13(10-8-12)18(30,19(21,22)23)20(24,25)26/h7-11,30H,4-6H2,1-3H3,(H,27,29) |
| InChIKey | AITHMULMPIQCKA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |