C11H13NO2S — CID 117121943
2-(6-methyl-1,1-dioxo-1-benzothiophen-3-yl)ethanamine (PubChem CID 117121943) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(6-methyl-1,1-dioxo-1-benzothiophen-3-yl)ethanamine.
| Compound Name | 2-(6-methyl-1,1-dioxo-1-benzothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 117121943 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-(6-methyl-1,1-dioxo-1-benzothiophen-3-yl)ethanamine |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)C=C2CCN |
| InChI | InChI=1S/C11H13NO2S/c1-8-2-3-10-9(4-5-12)7-15(13,14)11(10)6-8/h2-3,6-7H,4-5,12H2,1H3 |
| InChIKey | WWHCKCODKACCNA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |