6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid

C10H8O4S — CID 117121949

IUPAC6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid
SMILESCc1ccc2c(c1)S(=O)(=O)C=C2C(=O)O
InChIInChI=1S/C10H8O4S/c1-6-2-3-7-8(10(11)12)5-15(13,14)9(7)4-6/h2-5H,1H3,(H,11,12)
InChIKeyUNJMTMRTYKNUBL-UHFFFAOYSA-N
MW224.24 g/mol
LogP1.21
Rot. Bonds1

About 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid

6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid (PubChem CID 117121949) has the molecular formula C10H8O4S and a molecular weight of 224.24 g/mol. Its IUPAC name is 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid.

Molecular Properties

Compound Name6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid
PubChem CID117121949
Molecular FormulaC10H8O4S
Molecular Weight224.24 g/mol
Exact Mass224.01
IUPAC Name6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid
SMILESCc1ccc2c(c1)S(=O)(=O)C=C2C(=O)O
InChIInChI=1S/C10H8O4S/c1-6-2-3-7-8(10(11)12)5-15(13,14)9(7)4-6/h2-5H,1H3,(H,11,12)
InChIKeyUNJMTMRTYKNUBL-UHFFFAOYSA-N
XLogP1.21
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.24
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid (CID 117121949) is 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid is Cc1ccc2c(c1)S(=O)(=O)C=C2C(=O)O.
What is the InChIKey of 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid?
The InChIKey is UNJMTMRTYKNUBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4S/c1-6-2-3-7-8(10(11)12)5-15(13,14)9(7)4-6/h2-5H,1H3,(H,11,12).
What are the key properties of 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid?
6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid has a molecular weight of 224.24 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,1-dioxo-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 117121949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).