C11H11ClO3S — CID 117121969
1-(6-chloro-1,1-dioxo-1-benzothiophen-3-yl)propan-2-ol (PubChem CID 117121969) has the molecular formula C11H11ClO3S and a molecular weight of 258.73 g/mol. Its IUPAC name is 1-(6-chloro-1,1-dioxo-1-benzothiophen-3-yl)propan-2-ol.
| Compound Name | 1-(6-chloro-1,1-dioxo-1-benzothiophen-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 117121969 |
| Molecular Formula | C11H11ClO3S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 1-(6-chloro-1,1-dioxo-1-benzothiophen-3-yl)propan-2-ol |
| SMILES | CC(O)CC1=CS(=O)(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H11ClO3S/c1-7(13)4-8-6-16(14,15)11-5-9(12)2-3-10(8)11/h2-3,5-7,13H,4H2,1H3 |
| InChIKey | WSUUKIVJVKADSN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |