2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid

C12H12O4S — CID 117122495

IUPAC2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid
SMILESCc1ccc2c(c1)S(=O)(=O)C(C(C)C(=O)O)=C2
InChIInChI=1S/C12H12O4S/c1-7-3-4-9-6-10(8(2)12(13)14)17(15,16)11(9)5-7/h3-6,8H,1-2H3,(H,13,14)
InChIKeyGDFSCTWKJNYRKI-UHFFFAOYSA-N
MW252.29 g/mol
LogP1.84
Rot. Bonds2

About 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid

2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid (PubChem CID 117122495) has the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid.

Molecular Properties

Compound Name2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid
PubChem CID117122495
Molecular FormulaC12H12O4S
Molecular Weight252.29 g/mol
Exact Mass252.05
IUPAC Name2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid
SMILESCc1ccc2c(c1)S(=O)(=O)C(C(C)C(=O)O)=C2
InChIInChI=1S/C12H12O4S/c1-7-3-4-9-6-10(8(2)12(13)14)17(15,16)11(9)5-7/h3-6,8H,1-2H3,(H,13,14)
InChIKeyGDFSCTWKJNYRKI-UHFFFAOYSA-N
XLogP1.84
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.29
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid?
The IUPAC name of 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid (CID 117122495) is 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid.
What is the SMILES notation for 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid?
The canonical SMILES for 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid is Cc1ccc2c(c1)S(=O)(=O)C(C(C)C(=O)O)=C2.
What is the InChIKey of 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid?
The InChIKey is GDFSCTWKJNYRKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O4S/c1-7-3-4-9-6-10(8(2)12(13)14)17(15,16)11(9)5-7/h3-6,8H,1-2H3,(H,13,14).
What are the key properties of 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid?
2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid has a molecular weight of 252.29 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid is sourced from PubChem (CID 117122495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).