C12H12O4S — CID 117122495
2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid (PubChem CID 117122495) has the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid.
| Compound Name | 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 117122495 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-(6-methyl-1,1-dioxo-1-benzothiophen-2-yl)propanoic acid |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)C(C(C)C(=O)O)=C2 |
| InChI | InChI=1S/C12H12O4S/c1-7-3-4-9-6-10(8(2)12(13)14)17(15,16)11(9)5-7/h3-6,8H,1-2H3,(H,13,14) |
| InChIKey | GDFSCTWKJNYRKI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |