C12H14FN3O2 — CID 117123073
4-(3-aminopropyl)-2-(2-fluorophenyl)-3-hydroxy-1H-pyrazol-5-one (PubChem CID 117123073) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 4-(3-aminopropyl)-2-(2-fluorophenyl)-3-hydroxy-1H-pyrazol-5-one.
| Compound Name | 4-(3-aminopropyl)-2-(2-fluorophenyl)-3-hydroxy-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 117123073 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-(3-aminopropyl)-2-(2-fluorophenyl)-3-hydroxy-1H-pyrazol-5-one |
| SMILES | NCCCc1c(O)n(-c2ccccc2F)[nH]c1=O |
| InChI | InChI=1S/C12H14FN3O2/c13-9-5-1-2-6-10(9)16-12(18)8(4-3-7-14)11(17)15-16/h1-2,5-6,18H,3-4,7,14H2,(H,15,17) |
| InChIKey | IHVPGRJPXQYJRU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |