C27H37FO3S — CID 11712315
(4R,5R)-5-(4-fluorophenyl)-7-methyl-1,1-dioxo-3,3-dipentyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 11712315) has the molecular formula C27H37FO3S and a molecular weight of 460.66 g/mol. Its IUPAC name is (4R,5R)-5-(4-fluorophenyl)-7-methyl-1,1-dioxo-3,3-dipentyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (4R,5R)-5-(4-fluorophenyl)-7-methyl-1,1-dioxo-3,3-dipentyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 11712315 |
| Molecular Formula | C27H37FO3S |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (4R,5R)-5-(4-fluorophenyl)-7-methyl-1,1-dioxo-3,3-dipentyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCCCC1(CCCCC)CS(=O)(=O)c2ccc(C)cc2[C@@H](c2ccc(F)cc2)[C@H]1O |
| InChI | InChI=1S/C27H37FO3S/c1-4-6-8-16-27(17-9-7-5-2)19-32(30,31)24-15-10-20(3)18-23(24)25(26(27)29)21-11-13-22(28)14-12-21/h10-15,18,25-26,29H,4-9,16-17,19H2,1-3H3/t25-,26-/m1/s1 |
| InChIKey | IEKVOCOHLGSMDR-CLJLJLNGSA-N |
| XLogP | 6.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|