C22H29BrN2O2S — CID 11712407
[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[(5-methylthiophen-2-yl)methyl]-N-phenylcarbamate bromide (PubChem CID 11712407) has the molecular formula C22H29BrN2O2S and a molecular weight of 465.46 g/mol. Its IUPAC name is [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[(5-methylthiophen-2-yl)methyl]-N-phenylcarbamate bromide.
| Compound Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[(5-methylthiophen-2-yl)methyl]-N-phenylcarbamate bromide |
|---|---|
| PubChem CID | 11712407 |
| Molecular Formula | C22H29BrN2O2S |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[(5-methylthiophen-2-yl)methyl]-N-phenylcarbamate bromide |
| SMILES | Cc1ccc(CN(C(=O)OC2C[C@H]3CC[C@@H](C2)[N+]3(C)C)c2ccccc2)s1.[Br-] |
| InChI | InChI=1S/C22H29N2O2S.BrH/c1-16-9-12-21(27-16)15-23(17-7-5-4-6-8-17)22(25)26-20-13-18-10-11-19(14-20)24(18,2)3;/h4-9,12,18-20H,10-11,13-15H2,1-3H3;1H/q+1;/p-1/t18-,19+,20?; |
| InChIKey | ICHRMLKAANWUBU-IIPFOPBBSA-M |
| XLogP | 1.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|