About (4-tritylphenyl) trifluoromethanesulfonate
(4-tritylphenyl) trifluoromethanesulfonate (PubChem CID 11712469) has the molecular formula C26H19F3O3S
and a molecular weight of 468.50 g/mol. Its IUPAC name is (4-tritylphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (4-tritylphenyl) trifluoromethanesulfonate |
| PubChem CID | 11712469 |
| Molecular Formula | C26H19F3O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (4-tritylphenyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H19F3O3S/c27-26(28,29)33(30,31)32-24-18-16-23(17-19-24)25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19H |
| InChIKey | WMIFLEDWRTXFFZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (4-tritylphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tritylphenyl) trifluoromethanesulfonate?
The IUPAC name of (4-tritylphenyl) trifluoromethanesulfonate (CID 11712469) is (4-tritylphenyl) trifluoromethanesulfonate.
What is the SMILES notation for (4-tritylphenyl) trifluoromethanesulfonate?
The canonical SMILES for (4-tritylphenyl) trifluoromethanesulfonate is O=S(=O)(Oc1ccc(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of (4-tritylphenyl) trifluoromethanesulfonate?
The InChIKey is WMIFLEDWRTXFFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19F3O3S/c27-26(28,29)33(30,31)32-24-18-16-23(17-19-24)25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19H.
What are the key properties of (4-tritylphenyl) trifluoromethanesulfonate?
(4-tritylphenyl) trifluoromethanesulfonate has a molecular weight of 468.50 g/mol, XLogP of 6.30, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tritylphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 11712469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).