About 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine
1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine (PubChem CID 117124712) has the molecular formula C17H24N4O
and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine |
| PubChem CID | 117124712 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine |
| SMILES | COc1ccc(-n2nc(C)c(N3CCC(N)CC3)c2C)cc1 |
| InChI | InChI=1S/C17H24N4O/c1-12-17(20-10-8-14(18)9-11-20)13(2)21(19-12)15-4-6-16(22-3)7-5-15/h4-7,14H,8-11,18H2,1-3H3 |
| InChIKey | AOZKELVTSBTAPQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine?
The IUPAC name of 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine (CID 117124712) is 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine.
What is the SMILES notation for 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine?
The canonical SMILES for 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine is COc1ccc(-n2nc(C)c(N3CCC(N)CC3)c2C)cc1.
What is the InChIKey of 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine?
The InChIKey is AOZKELVTSBTAPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O/c1-12-17(20-10-8-14(18)9-11-20)13(2)21(19-12)15-4-6-16(22-3)7-5-15/h4-7,14H,8-11,18H2,1-3H3.
What are the key properties of 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine?
1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine has a molecular weight of 300.41 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]piperidin-4-amine is sourced from PubChem (CID 117124712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).