C15H16F3N3O — CID 117125009
1-(pyrrolidin-2-ylmethyl)-4-[2-(trifluoromethyl)phenoxy]pyrazole (PubChem CID 117125009) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is 1-(pyrrolidin-2-ylmethyl)-4-[2-(trifluoromethyl)phenoxy]pyrazole.
| Compound Name | 1-(pyrrolidin-2-ylmethyl)-4-[2-(trifluoromethyl)phenoxy]pyrazole |
|---|---|
| PubChem CID | 117125009 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(pyrrolidin-2-ylmethyl)-4-[2-(trifluoromethyl)phenoxy]pyrazole |
| SMILES | FC(F)(F)c1ccccc1Oc1cnn(CC2CCCN2)c1 |
| InChI | InChI=1S/C15H16F3N3O/c16-15(17,18)13-5-1-2-6-14(13)22-12-8-20-21(10-12)9-11-4-3-7-19-11/h1-2,5-6,8,10-11,19H,3-4,7,9H2 |
| InChIKey | FDTWLPYUGOSGOP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |