About (2-hydroxyphenyl) piperidine-4-carboxylate
(2-hydroxyphenyl) piperidine-4-carboxylate (PubChem CID 117125932) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is (2-hydroxyphenyl) piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl) piperidine-4-carboxylate |
| PubChem CID | 117125932 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (2-hydroxyphenyl) piperidine-4-carboxylate |
| SMILES | O=C(Oc1ccccc1O)C1CCNCC1 |
| InChI | InChI=1S/C12H15NO3/c14-10-3-1-2-4-11(10)16-12(15)9-5-7-13-8-6-9/h1-4,9,13-14H,5-8H2 |
| InChIKey | PSPJSXBONGYUJB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl) piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl) piperidine-4-carboxylate?
The IUPAC name of (2-hydroxyphenyl) piperidine-4-carboxylate (CID 117125932) is (2-hydroxyphenyl) piperidine-4-carboxylate.
What is the SMILES notation for (2-hydroxyphenyl) piperidine-4-carboxylate?
The canonical SMILES for (2-hydroxyphenyl) piperidine-4-carboxylate is O=C(Oc1ccccc1O)C1CCNCC1.
What is the InChIKey of (2-hydroxyphenyl) piperidine-4-carboxylate?
The InChIKey is PSPJSXBONGYUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c14-10-3-1-2-4-11(10)16-12(15)9-5-7-13-8-6-9/h1-4,9,13-14H,5-8H2.
What are the key properties of (2-hydroxyphenyl) piperidine-4-carboxylate?
(2-hydroxyphenyl) piperidine-4-carboxylate has a molecular weight of 221.26 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl) piperidine-4-carboxylate is sourced from PubChem (CID 117125932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).