C11H14N2O4 — CID 117127697
2-methyl-3-oxo-5-(oxolan-2-ylmethyl)pyridazine-4-carboxylic acid (PubChem CID 117127697) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-methyl-3-oxo-5-(oxolan-2-ylmethyl)pyridazine-4-carboxylic acid.
| Compound Name | 2-methyl-3-oxo-5-(oxolan-2-ylmethyl)pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 117127697 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-methyl-3-oxo-5-(oxolan-2-ylmethyl)pyridazine-4-carboxylic acid |
| SMILES | Cn1ncc(CC2CCCO2)c(C(=O)O)c1=O |
| InChI | InChI=1S/C11H14N2O4/c1-13-10(14)9(11(15)16)7(6-12-13)5-8-3-2-4-17-8/h6,8H,2-5H2,1H3,(H,15,16) |
| InChIKey | YDYBPABBVJSHLJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |