C11H13N3O3S — CID 117129655
2-(1,1-dioxothian-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-6-ol (PubChem CID 117129655) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-(1,1-dioxothian-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-6-ol.
| Compound Name | 2-(1,1-dioxothian-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-6-ol |
|---|---|
| PubChem CID | 117129655 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-(1,1-dioxothian-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-6-ol |
| SMILES | O=S1(=O)CCCCC1c1nc2ccc(O)cn2n1 |
| InChI | InChI=1S/C11H13N3O3S/c15-8-4-5-10-12-11(13-14(10)7-8)9-3-1-2-6-18(9,16)17/h4-5,7,9,15H,1-3,6H2 |
| InChIKey | DIORAQPAEWMKRF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |