C12H15N3S — CID 117129952
2-(thian-2-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117129952) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-(thian-2-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(thian-2-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117129952 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(thian-2-ylmethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1ccn2nc(CC3CCCCS3)nc2c1 |
| InChI | InChI=1S/C12H15N3S/c1-3-7-15-12(6-1)13-11(14-15)9-10-5-2-4-8-16-10/h1,3,6-7,10H,2,4-5,8-9H2 |
| InChIKey | VHDGXWYQPKNCJQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |