C28H35NO7 — CID 11713016
(4R)-4-benzyl-3-[(2R,3R,4R)-3-hydroxy-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methylpentanoyl]-1,3-oxazolidin-2-one (PubChem CID 11713016) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3R,4R)-3-hydroxy-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methylpentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3R,4R)-3-hydroxy-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methylpentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11713016 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3R,4R)-3-hydroxy-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methylpentanoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc([C@@H]2OC[C@@H](C)[C@H]([C@H](C)[C@@H](O)[C@@H](C)C(=O)N3C(=O)OC[C@H]3Cc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C28H35NO7/c1-17-15-34-27(21-10-12-23(33-4)13-11-21)36-25(17)18(2)24(30)19(3)26(31)29-22(16-35-28(29)32)14-20-8-6-5-7-9-20/h5-13,17-19,22,24-25,27,30H,14-16H2,1-4H3/t17-,18-,19-,22-,24-,25-,27-/m1/s1 |
| InChIKey | SPVRMGWYFPAWJR-JMSZPBMSSA-N |
| XLogP | 3.97 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |