C10H11N3O2 — CID 117131019
2-(3-hydroxypropyl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde (PubChem CID 117131019) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde.
| Compound Name | 2-(3-hydroxypropyl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 117131019 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(3-hydroxypropyl)-[1,2,4]triazolo[1,5-a]pyridine-5-carbaldehyde |
| SMILES | O=Cc1cccc2nc(CCCO)nn12 |
| InChI | InChI=1S/C10H11N3O2/c14-6-2-4-9-11-10-5-1-3-8(7-15)13(10)12-9/h1,3,5,7,14H,2,4,6H2 |
| InChIKey | WEGKXLGECMXDGO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|