C30H27N5OS — CID 11713130
1-(2-aminophenyl)-3-[[4-(2-methylsulfanyl-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methylamino]propan-1-one (PubChem CID 11713130) has the molecular formula C30H27N5OS and a molecular weight of 505.65 g/mol. Its IUPAC name is 1-(2-aminophenyl)-3-[[4-(2-methylsulfanyl-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methylamino]propan-1-one.
| Compound Name | 1-(2-aminophenyl)-3-[[4-(2-methylsulfanyl-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methylamino]propan-1-one |
|---|---|
| PubChem CID | 11713130 |
| Molecular Formula | C30H27N5OS |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 1-(2-aminophenyl)-3-[[4-(2-methylsulfanyl-6-phenylpyrido[2,3-d]pyrimidin-7-yl)phenyl]methylamino]propan-1-one |
| SMILES | CSc1ncc2cc(-c3ccccc3)c(-c3ccc(CNCCC(=O)c4ccccc4N)cc3)nc2n1 |
| InChI | InChI=1S/C30H27N5OS/c1-37-30-33-19-23-17-25(21-7-3-2-4-8-21)28(34-29(23)35-30)22-13-11-20(12-14-22)18-32-16-15-27(36)24-9-5-6-10-26(24)31/h2-14,17,19,32H,15-16,18,31H2,1H3 |
| InChIKey | LQOQPLJMWKFALQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|