About 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one
2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 117131519) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one.
Molecular Properties
| Compound Name | 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one |
| PubChem CID | 117131519 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | O=c1cccc2[nH]c(CC3CCS(=O)(=O)CC3)cn12 |
| InChI | InChI=1S/C13H16N2O3S/c16-13-3-1-2-12-14-11(9-15(12)13)8-10-4-6-19(17,18)7-5-10/h1-3,9-10,14H,4-8H2 |
| InChIKey | VUTXYBUCYBKVAE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one?
The IUPAC name of 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one (CID 117131519) is 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one.
What is the SMILES notation for 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one?
The canonical SMILES for 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one is O=c1cccc2[nH]c(CC3CCS(=O)(=O)CC3)cn12.
What is the InChIKey of 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one?
The InChIKey is VUTXYBUCYBKVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3S/c16-13-3-1-2-12-14-11(9-15(12)13)8-10-4-6-19(17,18)7-5-10/h1-3,9-10,14H,4-8H2.
What are the key properties of 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one?
2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one has a molecular weight of 280.35 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothian-4-yl)methyl]-1H-imidazo[1,2-a]pyridin-5-one is sourced from PubChem (CID 117131519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).