About 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one
2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 117131646) has the molecular formula C12H14N2O3S
and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one.
Molecular Properties
| Compound Name | 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one |
| PubChem CID | 117131646 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | O=c1cccc2[nH]c(C3CCCS(=O)(=O)C3)cn12 |
| InChI | InChI=1S/C12H14N2O3S/c15-12-5-1-4-11-13-10(7-14(11)12)9-3-2-6-18(16,17)8-9/h1,4-5,7,9,13H,2-3,6,8H2 |
| InChIKey | ARKVMBRXOSHZQR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one?
The IUPAC name of 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one (CID 117131646) is 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one.
What is the SMILES notation for 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one?
The canonical SMILES for 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one is O=c1cccc2[nH]c(C3CCCS(=O)(=O)C3)cn12.
What is the InChIKey of 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one?
The InChIKey is ARKVMBRXOSHZQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3S/c15-12-5-1-4-11-13-10(7-14(11)12)9-3-2-6-18(16,17)8-9/h1,4-5,7,9,13H,2-3,6,8H2.
What are the key properties of 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one?
2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one has a molecular weight of 266.32 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothian-3-yl)-1H-imidazo[1,2-a]pyridin-5-one is sourced from PubChem (CID 117131646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).