C24H22Cl2F3N3O2 — CID 11713229
N'-[1-(3-chlorophenyl)-2-(4-chlorophenyl)ethyl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanehydrazide (PubChem CID 11713229) has the molecular formula C24H22Cl2F3N3O2 and a molecular weight of 512.36 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)-2-(4-chlorophenyl)ethyl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanehydrazide.
| Compound Name | N'-[1-(3-chlorophenyl)-2-(4-chlorophenyl)ethyl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanehydrazide |
|---|---|
| PubChem CID | 11713229 |
| Molecular Formula | C24H22Cl2F3N3O2 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | N'-[1-(3-chlorophenyl)-2-(4-chlorophenyl)ethyl]-2-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propanehydrazide |
| SMILES | CC(C)(Oc1ccc(C(F)(F)F)cn1)C(=O)NNC(Cc1ccc(Cl)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H22Cl2F3N3O2/c1-23(2,34-21-11-8-17(14-30-21)24(27,28)29)22(33)32-31-20(16-4-3-5-19(26)13-16)12-15-6-9-18(25)10-7-15/h3-11,13-14,20,31H,12H2,1-2H3,(H,32,33) |
| InChIKey | WWFXJTFKEFTCAW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|