C23H25N5O4S3 — CID 11713493
N-[2-[1-(6-methoxy-1,5-naphthyridin-4-yl)pyrrolidin-3-yl]sulfanylethyl]-3-oxo-4H-1,4-benzothiazine-6-sulfonamide (PubChem CID 11713493) has the molecular formula C23H25N5O4S3 and a molecular weight of 531.69 g/mol. Its IUPAC name is N-[2-[1-(6-methoxy-1,5-naphthyridin-4-yl)pyrrolidin-3-yl]sulfanylethyl]-3-oxo-4H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | N-[2-[1-(6-methoxy-1,5-naphthyridin-4-yl)pyrrolidin-3-yl]sulfanylethyl]-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 11713493 |
| Molecular Formula | C23H25N5O4S3 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | N-[2-[1-(6-methoxy-1,5-naphthyridin-4-yl)pyrrolidin-3-yl]sulfanylethyl]-3-oxo-4H-1,4-benzothiazine-6-sulfonamide |
| SMILES | COc1ccc2nccc(N3CCC(SCCNS(=O)(=O)c4ccc5c(c4)NC(=O)CS5)C3)c2n1 |
| InChI | InChI=1S/C23H25N5O4S3/c1-32-22-5-3-17-23(27-22)19(6-8-24-17)28-10-7-15(13-28)33-11-9-25-35(30,31)16-2-4-20-18(12-16)26-21(29)14-34-20/h2-6,8,12,15,25H,7,9-11,13-14H2,1H3,(H,26,29) |
| InChIKey | JDUNOTDHYCPVRT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|