C10H14N4O — CID 117135717
2-(3-methoxypropyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 117135717) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | 2-(3-methoxypropyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 117135717 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(3-methoxypropyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | COCCCc1nc2c(N)cccn2n1 |
| InChI | InChI=1S/C10H14N4O/c1-15-7-3-5-9-12-10-8(11)4-2-6-14(10)13-9/h2,4,6H,3,5,7,11H2,1H3 |
| InChIKey | DMQFWKQASHJJRI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|