C12H15N3O — CID 117135935
8-methyl-2-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117135935) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 8-methyl-2-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-methyl-2-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117135935 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 8-methyl-2-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cccn2nc(C3CCOCC3)nc12 |
| InChI | InChI=1S/C12H15N3O/c1-9-3-2-6-15-12(9)13-11(14-15)10-4-7-16-8-5-10/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | UCDCPBBGNRZZBV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |