C14H12BrN3 — CID 117137359
2-[(2-bromophenyl)methyl]imidazo[1,2-a]pyridin-8-amine (PubChem CID 117137359) has the molecular formula C14H12BrN3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]imidazo[1,2-a]pyridin-8-amine.
| Compound Name | 2-[(2-bromophenyl)methyl]imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 117137359 |
| Molecular Formula | C14H12BrN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]imidazo[1,2-a]pyridin-8-amine |
| SMILES | Nc1cccn2cc(Cc3ccccc3Br)nc12 |
| InChI | InChI=1S/C14H12BrN3/c15-12-5-2-1-4-10(12)8-11-9-18-7-3-6-13(16)14(18)17-11/h1-7,9H,8,16H2 |
| InChIKey | CXVMZAPJWWBGBA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |