C13H8FN3O — CID 117137585
2-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbaldehyde (PubChem CID 117137585) has the molecular formula C13H8FN3O and a molecular weight of 241.23 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbaldehyde.
| Compound Name | 2-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbaldehyde |
|---|---|
| PubChem CID | 117137585 |
| Molecular Formula | C13H8FN3O |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carbaldehyde |
| SMILES | O=Cc1cccn2nc(-c3cccc(F)c3)nc12 |
| InChI | InChI=1S/C13H8FN3O/c14-11-5-1-3-9(7-11)12-15-13-10(8-18)4-2-6-17(13)16-12/h1-8H |
| InChIKey | MVPKIRUHFGYSPO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|