methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate

C12H13N3O2 — CID 117137744

IUPACmethyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate
SMILESCOC(=O)c1cccn2nc(C3CCC3)nc12
InChIInChI=1S/C12H13N3O2/c1-17-12(16)9-6-3-7-15-11(9)13-10(14-15)8-4-2-5-8/h3,6-8H,2,4-5H2,1H3
InChIKeyRQPWURVUSLADNM-UHFFFAOYSA-N
MW231.25 g/mol
LogP1.78
Rot. Bonds2

About methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate

methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate (PubChem CID 117137744) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate.

Molecular Properties

Compound Namemethyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate
PubChem CID117137744
Molecular FormulaC12H13N3O2
Molecular Weight231.25 g/mol
Exact Mass231.10
IUPAC Namemethyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate
SMILESCOC(=O)c1cccn2nc(C3CCC3)nc12
InChIInChI=1S/C12H13N3O2/c1-17-12(16)9-6-3-7-15-11(9)13-10(14-15)8-4-2-5-8/h3,6-8H,2,4-5H2,1H3
InChIKeyRQPWURVUSLADNM-UHFFFAOYSA-N
XLogP1.78
TPSA56.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 51.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate?
The IUPAC name of methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate (CID 117137744) is methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate.
What is the SMILES notation for methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate?
The canonical SMILES for methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate is COC(=O)c1cccn2nc(C3CCC3)nc12.
What is the InChIKey of methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate?
The InChIKey is RQPWURVUSLADNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c1-17-12(16)9-6-3-7-15-11(9)13-10(14-15)8-4-2-5-8/h3,6-8H,2,4-5H2,1H3.
What are the key properties of methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate?
methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate has a molecular weight of 231.25 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclobutyl-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate is sourced from PubChem (CID 117137744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).