C13H12N2S — CID 117137867
8-methyl-2-(thiophen-2-ylmethyl)imidazo[1,2-a]pyridine (PubChem CID 117137867) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 8-methyl-2-(thiophen-2-ylmethyl)imidazo[1,2-a]pyridine.
| Compound Name | 8-methyl-2-(thiophen-2-ylmethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117137867 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 8-methyl-2-(thiophen-2-ylmethyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1cccn2cc(Cc3cccs3)nc12 |
| InChI | InChI=1S/C13H12N2S/c1-10-4-2-6-15-9-11(14-13(10)15)8-12-5-3-7-16-12/h2-7,9H,8H2,1H3 |
| InChIKey | UARYOYAKKCCENT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |