C12H16N4 — CID 117138184
(3-pyrrolidin-3-ylimidazo[1,5-a]pyridin-6-yl)methanamine (PubChem CID 117138184) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is (3-pyrrolidin-3-ylimidazo[1,5-a]pyridin-6-yl)methanamine.
| Compound Name | (3-pyrrolidin-3-ylimidazo[1,5-a]pyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 117138184 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (3-pyrrolidin-3-ylimidazo[1,5-a]pyridin-6-yl)methanamine |
| SMILES | NCc1ccc2cnc(C3CCNC3)n2c1 |
| InChI | InChI=1S/C12H16N4/c13-5-9-1-2-11-7-15-12(16(11)8-9)10-3-4-14-6-10/h1-2,7-8,10,14H,3-6,13H2 |
| InChIKey | DOPKZCZHKPAODD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |