About 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde
3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde (PubChem CID 117138507) has the molecular formula C13H14N2OS
and a molecular weight of 246.33 g/mol. Its IUPAC name is 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde.
Molecular Properties
| Compound Name | 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde |
| PubChem CID | 117138507 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde |
| SMILES | O=Cc1ccc2cnc(C3CCCSC3)n2c1 |
| InChI | InChI=1S/C13H14N2OS/c16-8-10-3-4-12-6-14-13(15(12)7-10)11-2-1-5-17-9-11/h3-4,6-8,11H,1-2,5,9H2 |
| InChIKey | VLFLKAPSXRTEKJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde?
The IUPAC name of 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde (CID 117138507) is 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde.
What is the SMILES notation for 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde?
The canonical SMILES for 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde is O=Cc1ccc2cnc(C3CCCSC3)n2c1.
What is the InChIKey of 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde?
The InChIKey is VLFLKAPSXRTEKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2OS/c16-8-10-3-4-12-6-14-13(15(12)7-10)11-2-1-5-17-9-11/h3-4,6-8,11H,1-2,5,9H2.
What are the key properties of 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde?
3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde has a molecular weight of 246.33 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thian-3-yl)imidazo[1,5-a]pyridine-6-carbaldehyde is sourced from PubChem (CID 117138507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).